C13H18O3S — CID 79963801
(4-ethoxyphenyl)-(1,4-oxathian-2-yl)methanol (PubChem CID 79963801) has the molecular formula C13H18O3S and a molecular weight of 254.35 g/mol. Its IUPAC name is (4-ethoxyphenyl)-(1,4-oxathian-2-yl)methanol.
| Compound Name | (4-ethoxyphenyl)-(1,4-oxathian-2-yl)methanol |
|---|---|
| PubChem CID | 79963801 |
| Molecular Formula | C13H18O3S |
| Molecular Weight | 254.35 g/mol |
| Exact Mass | 254.10 |
| IUPAC Name | (4-ethoxyphenyl)-(1,4-oxathian-2-yl)methanol |
| SMILES | CCOc1ccc(C(O)C2CSCCO2)cc1 |
| InChI | InChI=1S/C13H18O3S/c1-2-15-11-5-3-10(4-6-11)13(14)12-9-17-8-7-16-12/h3-6,12-14H,2,7-9H2,1H3 |
| InChIKey | LTIFPKVMKBHAHQ-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.35 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |