C12H13F3O2S — CID 79963910
1,4-oxathian-2-yl-[3-(trifluoromethyl)phenyl]methanol (PubChem CID 79963910) has the molecular formula C12H13F3O2S and a molecular weight of 278.30 g/mol. Its IUPAC name is 1,4-oxathian-2-yl-[3-(trifluoromethyl)phenyl]methanol.
| Compound Name | 1,4-oxathian-2-yl-[3-(trifluoromethyl)phenyl]methanol |
|---|---|
| PubChem CID | 79963910 |
| Molecular Formula | C12H13F3O2S |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.06 |
| IUPAC Name | 1,4-oxathian-2-yl-[3-(trifluoromethyl)phenyl]methanol |
| SMILES | OC(c1cccc(C(F)(F)F)c1)C1CSCCO1 |
| InChI | InChI=1S/C12H13F3O2S/c13-12(14,15)9-3-1-2-8(6-9)11(16)10-7-18-5-4-17-10/h1-3,6,10-11,16H,4-5,7H2 |
| InChIKey | ODZIXYMUAWCDHT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |