C14H18O3S — CID 114521401
(3-cyclopropyloxyphenyl)-(1,4-oxathian-2-yl)methanol (PubChem CID 114521401) has the molecular formula C14H18O3S and a molecular weight of 266.36 g/mol. Its IUPAC name is (3-cyclopropyloxyphenyl)-(1,4-oxathian-2-yl)methanol.
| Compound Name | (3-cyclopropyloxyphenyl)-(1,4-oxathian-2-yl)methanol |
|---|---|
| PubChem CID | 114521401 |
| Molecular Formula | C14H18O3S |
| Molecular Weight | 266.36 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | (3-cyclopropyloxyphenyl)-(1,4-oxathian-2-yl)methanol |
| SMILES | OC(c1cccc(OC2CC2)c1)C1CSCCO1 |
| InChI | InChI=1S/C14H18O3S/c15-14(13-9-18-7-6-16-13)10-2-1-3-12(8-10)17-11-4-5-11/h1-3,8,11,13-15H,4-7,9H2 |
| InChIKey | BCXYFOGZFAOYMK-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.36 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |