C16H14F2O2 — CID 114521308
(3-cyclopropyloxyphenyl)-(3,5-difluorophenyl)methanol (PubChem CID 114521308) has the molecular formula C16H14F2O2 and a molecular weight of 276.28 g/mol. Its IUPAC name is (3-cyclopropyloxyphenyl)-(3,5-difluorophenyl)methanol.
| Compound Name | (3-cyclopropyloxyphenyl)-(3,5-difluorophenyl)methanol |
|---|---|
| PubChem CID | 114521308 |
| Molecular Formula | C16H14F2O2 |
| Molecular Weight | 276.28 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | (3-cyclopropyloxyphenyl)-(3,5-difluorophenyl)methanol |
| SMILES | OC(c1cc(F)cc(F)c1)c1cccc(OC2CC2)c1 |
| InChI | InChI=1S/C16H14F2O2/c17-12-6-11(7-13(18)9-12)16(19)10-2-1-3-15(8-10)20-14-4-5-14/h1-3,6-9,14,16,19H,4-5H2 |
| InChIKey | FDGZYKUZQCDFHQ-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.28 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |