C13H12ClNO2S — CID 107124992
(5-chloro-1,3-thiazol-2-yl)-(3-cyclopropyloxyphenyl)methanol (PubChem CID 107124992) has the molecular formula C13H12ClNO2S and a molecular weight of 281.76 g/mol. Its IUPAC name is (5-chloro-1,3-thiazol-2-yl)-(3-cyclopropyloxyphenyl)methanol.
| Compound Name | (5-chloro-1,3-thiazol-2-yl)-(3-cyclopropyloxyphenyl)methanol |
|---|---|
| PubChem CID | 107124992 |
| Molecular Formula | C13H12ClNO2S |
| Molecular Weight | 281.76 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | (5-chloro-1,3-thiazol-2-yl)-(3-cyclopropyloxyphenyl)methanol |
| SMILES | OC(c1cccc(OC2CC2)c1)c1ncc(Cl)s1 |
| InChI | InChI=1S/C13H12ClNO2S/c14-11-7-15-13(18-11)12(16)8-2-1-3-10(6-8)17-9-4-5-9/h1-3,6-7,9,12,16H,4-5H2 |
| InChIKey | NZYOHOXGTIRXGB-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.76 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |