C16H18O2S — CID 115838514
(3-cyclopropyloxyphenyl)-(3-ethylthiophen-2-yl)methanol (PubChem CID 115838514) has the molecular formula C16H18O2S and a molecular weight of 274.38 g/mol. Its IUPAC name is (3-cyclopropyloxyphenyl)-(3-ethylthiophen-2-yl)methanol.
| Compound Name | (3-cyclopropyloxyphenyl)-(3-ethylthiophen-2-yl)methanol |
|---|---|
| PubChem CID | 115838514 |
| Molecular Formula | C16H18O2S |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | (3-cyclopropyloxyphenyl)-(3-ethylthiophen-2-yl)methanol |
| SMILES | CCc1ccsc1C(O)c1cccc(OC2CC2)c1 |
| InChI | InChI=1S/C16H18O2S/c1-2-11-8-9-19-16(11)15(17)12-4-3-5-14(10-12)18-13-6-7-13/h3-5,8-10,13,15,17H,2,6-7H2,1H3 |
| InChIKey | PQZGBIRJOXVMFP-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |