C15H22O3 — CID 105131562
1-(3-cyclopropyloxyphenyl)-4-ethoxybutan-1-ol (PubChem CID 105131562) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is 1-(3-cyclopropyloxyphenyl)-4-ethoxybutan-1-ol.
| Compound Name | 1-(3-cyclopropyloxyphenyl)-4-ethoxybutan-1-ol |
|---|---|
| PubChem CID | 105131562 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | 1-(3-cyclopropyloxyphenyl)-4-ethoxybutan-1-ol |
| SMILES | CCOCCCC(O)c1cccc(OC2CC2)c1 |
| InChI | InChI=1S/C15H22O3/c1-2-17-10-4-7-15(16)12-5-3-6-14(11-12)18-13-8-9-13/h3,5-6,11,13,15-16H,2,4,7-10H2,1H3 |
| InChIKey | TVDFEOIUJTYJSI-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|