C17H26O2 — CID 115838526
1-(3-cyclopropyloxyphenyl)-3,4,4-trimethylpentan-1-ol (PubChem CID 115838526) has the molecular formula C17H26O2 and a molecular weight of 262.39 g/mol. Its IUPAC name is 1-(3-cyclopropyloxyphenyl)-3,4,4-trimethylpentan-1-ol.
| Compound Name | 1-(3-cyclopropyloxyphenyl)-3,4,4-trimethylpentan-1-ol |
|---|---|
| PubChem CID | 115838526 |
| Molecular Formula | C17H26O2 |
| Molecular Weight | 262.39 g/mol |
| Exact Mass | 262.19 |
| IUPAC Name | 1-(3-cyclopropyloxyphenyl)-3,4,4-trimethylpentan-1-ol |
| SMILES | CC(CC(O)c1cccc(OC2CC2)c1)C(C)(C)C |
| InChI | InChI=1S/C17H26O2/c1-12(17(2,3)4)10-16(18)13-6-5-7-15(11-13)19-14-8-9-14/h5-7,11-12,14,16,18H,8-10H2,1-4H3 |
| InChIKey | YCPSWTPQBBOGGE-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.39 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |