C18H28O2 — CID 115838493
1-(3-cyclopropyloxyphenyl)-3,5,5-trimethylhexan-1-ol (PubChem CID 115838493) has the molecular formula C18H28O2 and a molecular weight of 276.42 g/mol. Its IUPAC name is 1-(3-cyclopropyloxyphenyl)-3,5,5-trimethylhexan-1-ol.
| Compound Name | 1-(3-cyclopropyloxyphenyl)-3,5,5-trimethylhexan-1-ol |
|---|---|
| PubChem CID | 115838493 |
| Molecular Formula | C18H28O2 |
| Molecular Weight | 276.42 g/mol |
| Exact Mass | 276.21 |
| IUPAC Name | 1-(3-cyclopropyloxyphenyl)-3,5,5-trimethylhexan-1-ol |
| SMILES | CC(CC(O)c1cccc(OC2CC2)c1)CC(C)(C)C |
| InChI | InChI=1S/C18H28O2/c1-13(12-18(2,3)4)10-17(19)14-6-5-7-16(11-14)20-15-8-9-15/h5-7,11,13,15,17,19H,8-10,12H2,1-4H3 |
| InChIKey | VAWSOSVKYTUZOQ-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.42 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |