C19H22O2 — CID 115838522
1-(3-cyclopropyloxyphenyl)-2-(2,5-dimethylphenyl)ethanol (PubChem CID 115838522) has the molecular formula C19H22O2 and a molecular weight of 282.38 g/mol. Its IUPAC name is 1-(3-cyclopropyloxyphenyl)-2-(2,5-dimethylphenyl)ethanol.
| Compound Name | 1-(3-cyclopropyloxyphenyl)-2-(2,5-dimethylphenyl)ethanol |
|---|---|
| PubChem CID | 115838522 |
| Molecular Formula | C19H22O2 |
| Molecular Weight | 282.38 g/mol |
| Exact Mass | 282.16 |
| IUPAC Name | 1-(3-cyclopropyloxyphenyl)-2-(2,5-dimethylphenyl)ethanol |
| SMILES | Cc1ccc(C)c(CC(O)c2cccc(OC3CC3)c2)c1 |
| InChI | InChI=1S/C19H22O2/c1-13-6-7-14(2)16(10-13)12-19(20)15-4-3-5-18(11-15)21-17-8-9-17/h3-7,10-11,17,19-20H,8-9,12H2,1-2H3 |
| InChIKey | OVTJHAFYJVZGET-UHFFFAOYSA-N |
| XLogP | 4.12 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.38 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |