C18H20O2 — CID 114520837
(3-cyclopropyloxyphenyl)-(2,4-dimethylphenyl)methanol (PubChem CID 114520837) has the molecular formula C18H20O2 and a molecular weight of 268.36 g/mol. Its IUPAC name is (3-cyclopropyloxyphenyl)-(2,4-dimethylphenyl)methanol.
| Compound Name | (3-cyclopropyloxyphenyl)-(2,4-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 114520837 |
| Molecular Formula | C18H20O2 |
| Molecular Weight | 268.36 g/mol |
| Exact Mass | 268.15 |
| IUPAC Name | (3-cyclopropyloxyphenyl)-(2,4-dimethylphenyl)methanol |
| SMILES | Cc1ccc(C(O)c2cccc(OC3CC3)c2)c(C)c1 |
| InChI | InChI=1S/C18H20O2/c1-12-6-9-17(13(2)10-12)18(19)14-4-3-5-16(11-14)20-15-7-8-15/h3-6,9-11,15,18-19H,7-8H2,1-2H3 |
| InChIKey | ZZQCJBUJRFZDMT-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.36 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |