C16H16F2O — CID 115527668
[3-(difluoromethyl)phenyl]-(2,4-dimethylphenyl)methanol (PubChem CID 115527668) has the molecular formula C16H16F2O and a molecular weight of 262.30 g/mol. Its IUPAC name is [3-(difluoromethyl)phenyl]-(2,4-dimethylphenyl)methanol.
| Compound Name | [3-(difluoromethyl)phenyl]-(2,4-dimethylphenyl)methanol |
|---|---|
| PubChem CID | 115527668 |
| Molecular Formula | C16H16F2O |
| Molecular Weight | 262.30 g/mol |
| Exact Mass | 262.12 |
| IUPAC Name | [3-(difluoromethyl)phenyl]-(2,4-dimethylphenyl)methanol |
| SMILES | Cc1ccc(C(O)c2cccc(C(F)F)c2)c(C)c1 |
| InChI | InChI=1S/C16H16F2O/c1-10-6-7-14(11(2)8-10)15(19)12-4-3-5-13(9-12)16(17)18/h3-9,15-16,19H,1-2H3 |
| InChIKey | VUIDNNJMDUCSMT-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.30 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |