C14H12Br2O2S — CID 115838494
(3-cyclopropyloxyphenyl)-(4,5-dibromothiophen-2-yl)methanol (PubChem CID 115838494) has the molecular formula C14H12Br2O2S and a molecular weight of 404.12 g/mol. Its IUPAC name is (3-cyclopropyloxyphenyl)-(4,5-dibromothiophen-2-yl)methanol.
| Compound Name | (3-cyclopropyloxyphenyl)-(4,5-dibromothiophen-2-yl)methanol |
|---|---|
| PubChem CID | 115838494 |
| Molecular Formula | C14H12Br2O2S |
| Molecular Weight | 404.12 g/mol |
| Exact Mass | 401.89 |
| IUPAC Name | (3-cyclopropyloxyphenyl)-(4,5-dibromothiophen-2-yl)methanol |
| SMILES | OC(c1cccc(OC2CC2)c1)c1cc(Br)c(Br)s1 |
| InChI | InChI=1S/C14H12Br2O2S/c15-11-7-12(19-14(11)16)13(17)8-2-1-3-10(6-8)18-9-4-5-9/h1-3,6-7,9,13,17H,4-5H2 |
| InChIKey | QHZXUGGUZQBVCZ-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.12 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |