C14H14Br2O2S — CID 80535665
(4,5-dibromothiophen-2-yl)-(3-propoxyphenyl)methanol (PubChem CID 80535665) has the molecular formula C14H14Br2O2S and a molecular weight of 406.14 g/mol. Its IUPAC name is (4,5-dibromothiophen-2-yl)-(3-propoxyphenyl)methanol.
| Compound Name | (4,5-dibromothiophen-2-yl)-(3-propoxyphenyl)methanol |
|---|---|
| PubChem CID | 80535665 |
| Molecular Formula | C14H14Br2O2S |
| Molecular Weight | 406.14 g/mol |
| Exact Mass | 403.91 |
| IUPAC Name | (4,5-dibromothiophen-2-yl)-(3-propoxyphenyl)methanol |
| SMILES | CCCOc1cccc(C(O)c2cc(Br)c(Br)s2)c1 |
| InChI | InChI=1S/C14H14Br2O2S/c1-2-6-18-10-5-3-4-9(7-10)13(17)12-8-11(15)14(16)19-12/h3-5,7-8,13,17H,2,6H2,1H3 |
| InChIKey | BCRCPYKTIBQNLZ-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.14 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |