C15H16Br2O3S — CID 80533947
(4,5-dibromothiophen-2-yl)-(3,4-diethoxyphenyl)methanol (PubChem CID 80533947) has the molecular formula C15H16Br2O3S and a molecular weight of 436.17 g/mol. Its IUPAC name is (4,5-dibromothiophen-2-yl)-(3,4-diethoxyphenyl)methanol.
| Compound Name | (4,5-dibromothiophen-2-yl)-(3,4-diethoxyphenyl)methanol |
|---|---|
| PubChem CID | 80533947 |
| Molecular Formula | C15H16Br2O3S |
| Molecular Weight | 436.17 g/mol |
| Exact Mass | 433.92 |
| IUPAC Name | (4,5-dibromothiophen-2-yl)-(3,4-diethoxyphenyl)methanol |
| SMILES | CCOc1ccc(C(O)c2cc(Br)c(Br)s2)cc1OCC |
| InChI | InChI=1S/C15H16Br2O3S/c1-3-19-11-6-5-9(7-12(11)20-4-2)14(18)13-8-10(16)15(17)21-13/h5-8,14,18H,3-4H2,1-2H3 |
| InChIKey | IQVGADAJMPIGJV-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.17 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |