C13H16N2O3S — CID 105094432
(3,4-diethoxyphenyl)-(thiadiazol-5-yl)methanol (PubChem CID 105094432) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is (3,4-diethoxyphenyl)-(thiadiazol-5-yl)methanol.
| Compound Name | (3,4-diethoxyphenyl)-(thiadiazol-5-yl)methanol |
|---|---|
| PubChem CID | 105094432 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | (3,4-diethoxyphenyl)-(thiadiazol-5-yl)methanol |
| SMILES | CCOc1ccc(C(O)c2cnns2)cc1OCC |
| InChI | InChI=1S/C13H16N2O3S/c1-3-17-10-6-5-9(7-11(10)18-4-2)13(16)12-8-14-15-19-12/h5-8,13,16H,3-4H2,1-2H3 |
| InChIKey | BXISGEANKTWDDK-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 64.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |