C11H12N2OS — CID 105091691
(3,4-dimethylphenyl)-(thiadiazol-5-yl)methanol (PubChem CID 105091691) has the molecular formula C11H12N2OS and a molecular weight of 220.30 g/mol. Its IUPAC name is (3,4-dimethylphenyl)-(thiadiazol-5-yl)methanol.
| Compound Name | (3,4-dimethylphenyl)-(thiadiazol-5-yl)methanol |
|---|---|
| PubChem CID | 105091691 |
| Molecular Formula | C11H12N2OS |
| Molecular Weight | 220.30 g/mol |
| Exact Mass | 220.07 |
| IUPAC Name | (3,4-dimethylphenyl)-(thiadiazol-5-yl)methanol |
| SMILES | Cc1ccc(C(O)c2cnns2)cc1C |
| InChI | InChI=1S/C11H12N2OS/c1-7-3-4-9(5-8(7)2)11(14)10-6-12-13-15-10/h3-6,11,14H,1-2H3 |
| InChIKey | IJAKAKLWXRCYTK-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 220.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |