C16H18ClNO3 — CID 105094409
(3-chloro-4-pyridinyl)-(3,4-diethoxyphenyl)methanol (PubChem CID 105094409) has the molecular formula C16H18ClNO3 and a molecular weight of 307.78 g/mol. Its IUPAC name is (3-chloro-4-pyridinyl)-(3,4-diethoxyphenyl)methanol.
| Compound Name | (3-chloro-4-pyridinyl)-(3,4-diethoxyphenyl)methanol |
|---|---|
| PubChem CID | 105094409 |
| Molecular Formula | C16H18ClNO3 |
| Molecular Weight | 307.78 g/mol |
| Exact Mass | 307.10 |
| IUPAC Name | (3-chloro-4-pyridinyl)-(3,4-diethoxyphenyl)methanol |
| SMILES | CCOc1ccc(C(O)c2ccncc2Cl)cc1OCC |
| InChI | InChI=1S/C16H18ClNO3/c1-3-20-14-6-5-11(9-15(14)21-4-2)16(19)12-7-8-18-10-13(12)17/h5-10,16,19H,3-4H2,1-2H3 |
| InChIKey | HFYAMWDPGVGCSN-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 51.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.78 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |