C15H20N2O3 — CID 61088204
(3,4-diethoxyphenyl)-(1-methylpyrazol-4-yl)methanol (PubChem CID 61088204) has the molecular formula C15H20N2O3 and a molecular weight of 276.34 g/mol. Its IUPAC name is (3,4-diethoxyphenyl)-(1-methylpyrazol-4-yl)methanol.
| Compound Name | (3,4-diethoxyphenyl)-(1-methylpyrazol-4-yl)methanol |
|---|---|
| PubChem CID | 61088204 |
| Molecular Formula | C15H20N2O3 |
| Molecular Weight | 276.34 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (3,4-diethoxyphenyl)-(1-methylpyrazol-4-yl)methanol |
| SMILES | CCOc1ccc(C(O)c2cnn(C)c2)cc1OCC |
| InChI | InChI=1S/C15H20N2O3/c1-4-19-13-7-6-11(8-14(13)20-5-2)15(18)12-9-16-17(3)10-12/h6-10,15,18H,4-5H2,1-3H3 |
| InChIKey | NTFUFUJNKZXESA-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.34 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |