C14H14Br2OS — CID 80537952
(4,5-dibromothiophen-2-yl)-(4-propylphenyl)methanol (PubChem CID 80537952) has the molecular formula C14H14Br2OS and a molecular weight of 390.14 g/mol. Its IUPAC name is (4,5-dibromothiophen-2-yl)-(4-propylphenyl)methanol.
| Compound Name | (4,5-dibromothiophen-2-yl)-(4-propylphenyl)methanol |
|---|---|
| PubChem CID | 80537952 |
| Molecular Formula | C14H14Br2OS |
| Molecular Weight | 390.14 g/mol |
| Exact Mass | 387.91 |
| IUPAC Name | (4,5-dibromothiophen-2-yl)-(4-propylphenyl)methanol |
| SMILES | CCCc1ccc(C(O)c2cc(Br)c(Br)s2)cc1 |
| InChI | InChI=1S/C14H14Br2OS/c1-2-3-9-4-6-10(7-5-9)13(17)12-8-11(15)14(16)18-12/h4-8,13,17H,2-3H2,1H3 |
| InChIKey | WTWWBXMLYIDQJY-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.14 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |