C15H16Br2OS — CID 115482630
(4,5-dibromothiophen-2-yl)-(3,4-diethylphenyl)methanol (PubChem CID 115482630) has the molecular formula C15H16Br2OS and a molecular weight of 404.17 g/mol. Its IUPAC name is (4,5-dibromothiophen-2-yl)-(3,4-diethylphenyl)methanol.
| Compound Name | (4,5-dibromothiophen-2-yl)-(3,4-diethylphenyl)methanol |
|---|---|
| PubChem CID | 115482630 |
| Molecular Formula | C15H16Br2OS |
| Molecular Weight | 404.17 g/mol |
| Exact Mass | 401.93 |
| IUPAC Name | (4,5-dibromothiophen-2-yl)-(3,4-diethylphenyl)methanol |
| SMILES | CCc1ccc(C(O)c2cc(Br)c(Br)s2)cc1CC |
| InChI | InChI=1S/C15H16Br2OS/c1-3-9-5-6-11(7-10(9)4-2)14(18)13-8-12(16)15(17)19-13/h5-8,14,18H,3-4H2,1-2H3 |
| InChIKey | ZBDOVZQGKWLGIK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.17 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |