About (4,5-dibromothiophen-2-yl)-(3,4-diethylphenyl)methanol
(4,5-dibromothiophen-2-yl)-(3,4-diethylphenyl)methanol (PubChem CID 115482630) has the molecular formula C15H16Br2OS
and a molecular weight of 404.17 g/mol. Its IUPAC name is (4,5-dibromothiophen-2-yl)-(3,4-diethylphenyl)methanol.
Molecular Properties
| Compound Name | (4,5-dibromothiophen-2-yl)-(3,4-diethylphenyl)methanol |
| PubChem CID | 115482630 |
| Molecular Formula | C15H16Br2OS |
| Molecular Weight | 404.17 g/mol |
| Exact Mass | 401.93 |
| IUPAC Name | (4,5-dibromothiophen-2-yl)-(3,4-diethylphenyl)methanol |
| SMILES | CCc1ccc(C(O)c2cc(Br)c(Br)s2)cc1CC |
| InChI | InChI=1S/C15H16Br2OS/c1-3-9-5-6-11(7-10(9)4-2)14(18)13-8-12(16)15(17)19-13/h5-8,14,18H,3-4H2,1-2H3 |
| InChIKey | ZBDOVZQGKWLGIK-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 404.17 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (4,5-dibromothiophen-2-yl)-(3,4-diethylphenyl)methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4,5-dibromothiophen-2-yl)-(3,4-diethylphenyl)methanol?
The IUPAC name of (4,5-dibromothiophen-2-yl)-(3,4-diethylphenyl)methanol (CID 115482630) is (4,5-dibromothiophen-2-yl)-(3,4-diethylphenyl)methanol.
What is the SMILES notation for (4,5-dibromothiophen-2-yl)-(3,4-diethylphenyl)methanol?
The canonical SMILES for (4,5-dibromothiophen-2-yl)-(3,4-diethylphenyl)methanol is CCc1ccc(C(O)c2cc(Br)c(Br)s2)cc1CC.
What is the InChIKey of (4,5-dibromothiophen-2-yl)-(3,4-diethylphenyl)methanol?
The InChIKey is ZBDOVZQGKWLGIK-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16Br2OS/c1-3-9-5-6-11(7-10(9)4-2)14(18)13-8-12(16)15(17)19-13/h5-8,14,18H,3-4H2,1-2H3.
What are the key properties of (4,5-dibromothiophen-2-yl)-(3,4-diethylphenyl)methanol?
(4,5-dibromothiophen-2-yl)-(3,4-diethylphenyl)methanol has a molecular weight of 404.17 g/mol, XLogP of 5.48, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (4,5-dibromothiophen-2-yl)-(3,4-diethylphenyl)methanol is sourced from PubChem (CID 115482630), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).