C17H19BrO — CID 115482670
(2-bromophenyl)-(3,4-diethylphenyl)methanol (PubChem CID 115482670) has the molecular formula C17H19BrO and a molecular weight of 319.24 g/mol. Its IUPAC name is (2-bromophenyl)-(3,4-diethylphenyl)methanol.
| Compound Name | (2-bromophenyl)-(3,4-diethylphenyl)methanol |
|---|---|
| PubChem CID | 115482670 |
| Molecular Formula | C17H19BrO |
| Molecular Weight | 319.24 g/mol |
| Exact Mass | 318.06 |
| IUPAC Name | (2-bromophenyl)-(3,4-diethylphenyl)methanol |
| SMILES | CCc1ccc(C(O)c2ccccc2Br)cc1CC |
| InChI | InChI=1S/C17H19BrO/c1-3-12-9-10-14(11-13(12)4-2)17(19)15-7-5-6-8-16(15)18/h5-11,17,19H,3-4H2,1-2H3 |
| InChIKey | GTAPYHSSKJGWNO-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.24 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |