C16H16Br2O — CID 114374739
(2,5-dibromophenyl)-(4-propylphenyl)methanol (PubChem CID 114374739) has the molecular formula C16H16Br2O and a molecular weight of 384.11 g/mol. Its IUPAC name is (2,5-dibromophenyl)-(4-propylphenyl)methanol.
| Compound Name | (2,5-dibromophenyl)-(4-propylphenyl)methanol |
|---|---|
| PubChem CID | 114374739 |
| Molecular Formula | C16H16Br2O |
| Molecular Weight | 384.11 g/mol |
| Exact Mass | 381.96 |
| IUPAC Name | (2,5-dibromophenyl)-(4-propylphenyl)methanol |
| SMILES | CCCc1ccc(C(O)c2cc(Br)ccc2Br)cc1 |
| InChI | InChI=1S/C16H16Br2O/c1-2-3-11-4-6-12(7-5-11)16(19)14-10-13(17)8-9-15(14)18/h4-10,16,19H,2-3H2,1H3 |
| InChIKey | ZVFIRQGCZHIOMX-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.11 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |