C15H21NOS — CID 114603995
(3-cyclobutylphenyl)-(1,4-oxathian-2-yl)methanamine (PubChem CID 114603995) has the molecular formula C15H21NOS and a molecular weight of 263.41 g/mol. Its IUPAC name is (3-cyclobutylphenyl)-(1,4-oxathian-2-yl)methanamine.
| Compound Name | (3-cyclobutylphenyl)-(1,4-oxathian-2-yl)methanamine |
|---|---|
| PubChem CID | 114603995 |
| Molecular Formula | C15H21NOS |
| Molecular Weight | 263.41 g/mol |
| Exact Mass | 263.13 |
| IUPAC Name | (3-cyclobutylphenyl)-(1,4-oxathian-2-yl)methanamine |
| SMILES | NC(c1cccc(C2CCC2)c1)C1CSCCO1 |
| InChI | InChI=1S/C15H21NOS/c16-15(14-10-18-8-7-17-14)13-6-2-5-12(9-13)11-3-1-4-11/h2,5-6,9,11,14-15H,1,3-4,7-8,10,16H2 |
| InChIKey | ZGGVJSIUORJLBT-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.41 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |