C11H15NO2S — CID 115374196
(5-methyl-3-pyridinyl)-(1,4-oxathian-2-yl)methanol (PubChem CID 115374196) has the molecular formula C11H15NO2S and a molecular weight of 225.31 g/mol. Its IUPAC name is (5-methyl-3-pyridinyl)-(1,4-oxathian-2-yl)methanol.
| Compound Name | (5-methyl-3-pyridinyl)-(1,4-oxathian-2-yl)methanol |
|---|---|
| PubChem CID | 115374196 |
| Molecular Formula | C11H15NO2S |
| Molecular Weight | 225.31 g/mol |
| Exact Mass | 225.08 |
| IUPAC Name | (5-methyl-3-pyridinyl)-(1,4-oxathian-2-yl)methanol |
| SMILES | Cc1cncc(C(O)C2CSCCO2)c1 |
| InChI | InChI=1S/C11H15NO2S/c1-8-4-9(6-12-5-8)11(13)10-7-15-3-2-14-10/h4-6,10-11,13H,2-3,7H2,1H3 |
| InChIKey | NTAPTESCEPNTCR-UHFFFAOYSA-N |
| XLogP | 1.56 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.31 |
| LogP ≤ 5 | 1.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |