C10H14O2S2 — CID 102831462
(2-methylthiophen-3-yl)-(1,4-oxathian-2-yl)methanol (PubChem CID 102831462) has the molecular formula C10H14O2S2 and a molecular weight of 230.35 g/mol. Its IUPAC name is (2-methylthiophen-3-yl)-(1,4-oxathian-2-yl)methanol.
| Compound Name | (2-methylthiophen-3-yl)-(1,4-oxathian-2-yl)methanol |
|---|---|
| PubChem CID | 102831462 |
| Molecular Formula | C10H14O2S2 |
| Molecular Weight | 230.35 g/mol |
| Exact Mass | 230.04 |
| IUPAC Name | (2-methylthiophen-3-yl)-(1,4-oxathian-2-yl)methanol |
| SMILES | Cc1sccc1C(O)C1CSCCO1 |
| InChI | InChI=1S/C10H14O2S2/c1-7-8(2-4-14-7)10(11)9-6-13-5-3-12-9/h2,4,9-11H,3,5-6H2,1H3 |
| InChIKey | TVVRVCADDDHOMC-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.35 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |