C12H18OS — CID 102831364
(3-methylcyclopentyl)-(2-methylthiophen-3-yl)methanol (PubChem CID 102831364) has the molecular formula C12H18OS and a molecular weight of 210.34 g/mol. Its IUPAC name is (3-methylcyclopentyl)-(2-methylthiophen-3-yl)methanol.
| Compound Name | (3-methylcyclopentyl)-(2-methylthiophen-3-yl)methanol |
|---|---|
| PubChem CID | 102831364 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | (3-methylcyclopentyl)-(2-methylthiophen-3-yl)methanol |
| SMILES | Cc1sccc1C(O)C1CCC(C)C1 |
| InChI | InChI=1S/C12H18OS/c1-8-3-4-10(7-8)12(13)11-5-6-14-9(11)2/h5-6,8,10,12-13H,3-4,7H2,1-2H3 |
| InChIKey | DYYLZQQHLHHXKR-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |