C7H14O2 — CID 163440646
[(1R,3S)-3-methylcyclopentyl]methanediol (PubChem CID 163440646) has the molecular formula C7H14O2 and a molecular weight of 130.19 g/mol. Its IUPAC name is [(1R,3S)-3-methylcyclopentyl]methanediol.
| Compound Name | [(1R,3S)-3-methylcyclopentyl]methanediol |
|---|---|
| PubChem CID | 163440646 |
| Molecular Formula | C7H14O2 |
| Molecular Weight | 130.19 g/mol |
| Exact Mass | 130.10 |
| IUPAC Name | [(1R,3S)-3-methylcyclopentyl]methanediol |
| SMILES | C[C@H]1CC[C@@H](C(O)O)C1 |
| InChI | InChI=1S/C7H14O2/c1-5-2-3-6(4-5)7(8)9/h5-9H,2-4H2,1H3/t5-,6+/m0/s1 |
| InChIKey | AYFYHKDGWGKJAJ-NTSWFWBYSA-N |
| XLogP | 0.73 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 130.19 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|