About [(1S,3S)-3-aminocyclopentyl]methanediol
[(1S,3S)-3-aminocyclopentyl]methanediol (PubChem CID 156547371) has the molecular formula C6H13NO2
and a molecular weight of 131.18 g/mol. Its IUPAC name is [(1S,3S)-3-aminocyclopentyl]methanediol.
Molecular Properties
| Compound Name | [(1S,3S)-3-aminocyclopentyl]methanediol |
| PubChem CID | 156547371 |
| Molecular Formula | C6H13NO2 |
| Molecular Weight | 131.18 g/mol |
| Exact Mass | 131.09 |
| IUPAC Name | [(1S,3S)-3-aminocyclopentyl]methanediol |
| SMILES | N[C@H]1CC[C@H](C(O)O)C1 |
| InChI | InChI=1S/C6H13NO2/c7-5-2-1-4(3-5)6(8)9/h4-6,8-9H,1-3,7H2/t4-,5-/m0/s1 |
| InChIKey | ZYANUEKCFCIBBI-WHFBIAKZSA-N |
| XLogP | -0.58 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 131.18 |
| LogP ≤ 5 | -0.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze [(1S,3S)-3-aminocyclopentyl]methanediol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,3S)-3-aminocyclopentyl]methanediol?
The IUPAC name of [(1S,3S)-3-aminocyclopentyl]methanediol (CID 156547371) is [(1S,3S)-3-aminocyclopentyl]methanediol.
What is the SMILES notation for [(1S,3S)-3-aminocyclopentyl]methanediol?
The canonical SMILES for [(1S,3S)-3-aminocyclopentyl]methanediol is N[C@H]1CC[C@H](C(O)O)C1.
What is the InChIKey of [(1S,3S)-3-aminocyclopentyl]methanediol?
The InChIKey is ZYANUEKCFCIBBI-WHFBIAKZSA-N. The full InChI is InChI=1S/C6H13NO2/c7-5-2-1-4(3-5)6(8)9/h4-6,8-9H,1-3,7H2/t4-,5-/m0/s1.
What are the key properties of [(1S,3S)-3-aminocyclopentyl]methanediol?
[(1S,3S)-3-aminocyclopentyl]methanediol has a molecular weight of 131.18 g/mol, XLogP of -0.58, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,3S)-3-aminocyclopentyl]methanediol is sourced from PubChem (CID 156547371), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).