C9H13NO2S2 — CID 130964765
(2-methyl-1,3-thiazol-4-yl)-(1,4-oxathian-2-yl)methanol (PubChem CID 130964765) has the molecular formula C9H13NO2S2 and a molecular weight of 231.34 g/mol. Its IUPAC name is (2-methyl-1,3-thiazol-4-yl)-(1,4-oxathian-2-yl)methanol.
| Compound Name | (2-methyl-1,3-thiazol-4-yl)-(1,4-oxathian-2-yl)methanol |
|---|---|
| PubChem CID | 130964765 |
| Molecular Formula | C9H13NO2S2 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.04 |
| IUPAC Name | (2-methyl-1,3-thiazol-4-yl)-(1,4-oxathian-2-yl)methanol |
| SMILES | Cc1nc(C(O)C2CSCCO2)cs1 |
| InChI | InChI=1S/C9H13NO2S2/c1-6-10-7(4-14-6)9(11)8-5-13-3-2-12-8/h4,8-9,11H,2-3,5H2,1H3 |
| InChIKey | IZYHFOBASXXZSK-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 42.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |