C11H12ClFO2S — CID 105394546
(2-chloro-5-fluorophenyl)-(1,4-oxathian-2-yl)methanol (PubChem CID 105394546) has the molecular formula C11H12ClFO2S and a molecular weight of 262.73 g/mol. Its IUPAC name is (2-chloro-5-fluorophenyl)-(1,4-oxathian-2-yl)methanol.
| Compound Name | (2-chloro-5-fluorophenyl)-(1,4-oxathian-2-yl)methanol |
|---|---|
| PubChem CID | 105394546 |
| Molecular Formula | C11H12ClFO2S |
| Molecular Weight | 262.73 g/mol |
| Exact Mass | 262.02 |
| IUPAC Name | (2-chloro-5-fluorophenyl)-(1,4-oxathian-2-yl)methanol |
| SMILES | OC(c1cc(F)ccc1Cl)C1CSCCO1 |
| InChI | InChI=1S/C11H12ClFO2S/c12-9-2-1-7(13)5-8(9)11(14)10-6-16-4-3-15-10/h1-2,5,10-11,14H,3-4,6H2 |
| InChIKey | MERRSCPHWUGYDD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.73 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |