C11H13ClFNOS — CID 105395270
(2-chloro-5-fluorophenyl)-(1,4-oxathian-2-yl)methanamine (PubChem CID 105395270) has the molecular formula C11H13ClFNOS and a molecular weight of 261.75 g/mol. Its IUPAC name is (2-chloro-5-fluorophenyl)-(1,4-oxathian-2-yl)methanamine.
| Compound Name | (2-chloro-5-fluorophenyl)-(1,4-oxathian-2-yl)methanamine |
|---|---|
| PubChem CID | 105395270 |
| Molecular Formula | C11H13ClFNOS |
| Molecular Weight | 261.75 g/mol |
| Exact Mass | 261.04 |
| IUPAC Name | (2-chloro-5-fluorophenyl)-(1,4-oxathian-2-yl)methanamine |
| SMILES | NC(c1cc(F)ccc1Cl)C1CSCCO1 |
| InChI | InChI=1S/C11H13ClFNOS/c12-9-2-1-7(13)5-8(9)11(14)10-6-16-4-3-15-10/h1-2,5,10-11H,3-4,6,14H2 |
| InChIKey | JWKRUKJVVYKRLP-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.75 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |