C6H13NOS — CID 104932096
(1R)-1-(1,4-oxathian-2-yl)ethanamine (PubChem CID 104932096) has the molecular formula C6H13NOS and a molecular weight of 147.24 g/mol. Its IUPAC name is (1R)-1-(1,4-oxathian-2-yl)ethanamine.
| Compound Name | (1R)-1-(1,4-oxathian-2-yl)ethanamine |
|---|---|
| PubChem CID | 104932096 |
| Molecular Formula | C6H13NOS |
| Molecular Weight | 147.24 g/mol |
| Exact Mass | 147.07 |
| IUPAC Name | (1R)-1-(1,4-oxathian-2-yl)ethanamine |
| SMILES | C[C@@H](N)C1CSCCO1 |
| InChI | InChI=1S/C6H13NOS/c1-5(7)6-4-9-3-2-8-6/h5-6H,2-4,7H2,1H3/t5-,6?/m1/s1 |
| InChIKey | NDXRGBOKXWWZKA-LWOQYNTDSA-N |
| XLogP | 0.47 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 147.24 |
| LogP ≤ 5 | 0.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |