C9H15NOS — CID 79963123
1-(1,4-oxathian-2-yl)pent-3-yn-1-amine (PubChem CID 79963123) has the molecular formula C9H15NOS and a molecular weight of 185.29 g/mol. Its IUPAC name is 1-(1,4-oxathian-2-yl)pent-3-yn-1-amine.
| Compound Name | 1-(1,4-oxathian-2-yl)pent-3-yn-1-amine |
|---|---|
| PubChem CID | 79963123 |
| Molecular Formula | C9H15NOS |
| Molecular Weight | 185.29 g/mol |
| Exact Mass | 185.09 |
| IUPAC Name | 1-(1,4-oxathian-2-yl)pent-3-yn-1-amine |
| SMILES | CC#CCC(N)C1CSCCO1 |
| InChI | InChI=1S/C9H15NOS/c1-2-3-4-8(10)9-7-12-6-5-11-9/h8-9H,4-7,10H2,1H3 |
| InChIKey | ZLPVFMAOLISQFA-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 185.29 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|