C7H11NOS — CID 79962917
1-(1,4-oxathian-2-yl)prop-2-yn-1-amine (PubChem CID 79962917) has the molecular formula C7H11NOS and a molecular weight of 157.24 g/mol. Its IUPAC name is 1-(1,4-oxathian-2-yl)prop-2-yn-1-amine.
| Compound Name | 1-(1,4-oxathian-2-yl)prop-2-yn-1-amine |
|---|---|
| PubChem CID | 79962917 |
| Molecular Formula | C7H11NOS |
| Molecular Weight | 157.24 g/mol |
| Exact Mass | 157.06 |
| IUPAC Name | 1-(1,4-oxathian-2-yl)prop-2-yn-1-amine |
| SMILES | C#CC(N)C1CSCCO1 |
| InChI | InChI=1S/C7H11NOS/c1-2-6(8)7-5-10-4-3-9-7/h1,6-7H,3-5,8H2 |
| InChIKey | HQEKTBWQAAHTQT-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.24 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|