C9H17NO2S — CID 79963411
1,4-oxathian-2-yl(oxolan-3-yl)methanamine (PubChem CID 79963411) has the molecular formula C9H17NO2S and a molecular weight of 203.31 g/mol. Its IUPAC name is 1,4-oxathian-2-yl(oxolan-3-yl)methanamine.
| Compound Name | 1,4-oxathian-2-yl(oxolan-3-yl)methanamine |
|---|---|
| PubChem CID | 79963411 |
| Molecular Formula | C9H17NO2S |
| Molecular Weight | 203.31 g/mol |
| Exact Mass | 203.10 |
| IUPAC Name | 1,4-oxathian-2-yl(oxolan-3-yl)methanamine |
| SMILES | NC(C1CCOC1)C1CSCCO1 |
| InChI | InChI=1S/C9H17NO2S/c10-9(7-1-2-11-5-7)8-6-13-4-3-12-8/h7-9H,1-6,10H2 |
| InChIKey | PHWONYMAKLTXRE-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.31 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |