C10H20N2OS — CID 105249541
[cyclopentyl(1,4-oxathian-2-yl)methyl]hydrazine (PubChem CID 105249541) has the molecular formula C10H20N2OS and a molecular weight of 216.35 g/mol. Its IUPAC name is [cyclopentyl(1,4-oxathian-2-yl)methyl]hydrazine.
| Compound Name | [cyclopentyl(1,4-oxathian-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105249541 |
| Molecular Formula | C10H20N2OS |
| Molecular Weight | 216.35 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | [cyclopentyl(1,4-oxathian-2-yl)methyl]hydrazine |
| SMILES | NNC(C1CCCC1)C1CSCCO1 |
| InChI | InChI=1S/C10H20N2OS/c11-12-10(8-3-1-2-4-8)9-7-14-6-5-13-9/h8-10,12H,1-7,11H2 |
| InChIKey | DMWSQJNGEXEACH-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|