C14H26N2O2S2 — CID 105249551
[1,4-oxathian-2-yl(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methyl]hydrazine (PubChem CID 105249551) has the molecular formula C14H26N2O2S2 and a molecular weight of 318.51 g/mol. Its IUPAC name is [1,4-oxathian-2-yl(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methyl]hydrazine.
| Compound Name | [1,4-oxathian-2-yl(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105249551 |
| Molecular Formula | C14H26N2O2S2 |
| Molecular Weight | 318.51 g/mol |
| Exact Mass | 318.14 |
| IUPAC Name | [1,4-oxathian-2-yl(1-oxa-9-thiaspiro[5.5]undecan-4-yl)methyl]hydrazine |
| SMILES | NNC(C1CCOC2(CCSCC2)C1)C1CSCCO1 |
| InChI | InChI=1S/C14H26N2O2S2/c15-16-13(12-10-20-8-5-17-12)11-1-4-18-14(9-11)2-6-19-7-3-14/h11-13,16H,1-10,15H2 |
| InChIKey | ZZMKZJBKKSDZSL-UHFFFAOYSA-N |
| XLogP | 1.64 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.51 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|