C15H28N2O2S2 — CID 105259501
[1,9-dioxaspiro[5.5]undecan-4-yl-(3-methyl-1,4-dithian-2-yl)methyl]hydrazine (PubChem CID 105259501) has the molecular formula C15H28N2O2S2 and a molecular weight of 332.54 g/mol. Its IUPAC name is [1,9-dioxaspiro[5.5]undecan-4-yl-(3-methyl-1,4-dithian-2-yl)methyl]hydrazine.
| Compound Name | [1,9-dioxaspiro[5.5]undecan-4-yl-(3-methyl-1,4-dithian-2-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105259501 |
| Molecular Formula | C15H28N2O2S2 |
| Molecular Weight | 332.54 g/mol |
| Exact Mass | 332.16 |
| IUPAC Name | [1,9-dioxaspiro[5.5]undecan-4-yl-(3-methyl-1,4-dithian-2-yl)methyl]hydrazine |
| SMILES | CC1SCCSC1C(NN)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C15H28N2O2S2/c1-11-14(21-9-8-20-11)13(17-16)12-2-5-19-15(10-12)3-6-18-7-4-15/h11-14,17H,2-10,16H2,1H3 |
| InChIKey | HCHRZKMDXPTMBI-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.54 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|