C15H28N2O2 — CID 105204290
[cyclopentyl(1,9-dioxaspiro[5.5]undecan-4-yl)methyl]hydrazine (PubChem CID 105204290) has the molecular formula C15H28N2O2 and a molecular weight of 268.40 g/mol. Its IUPAC name is [cyclopentyl(1,9-dioxaspiro[5.5]undecan-4-yl)methyl]hydrazine.
| Compound Name | [cyclopentyl(1,9-dioxaspiro[5.5]undecan-4-yl)methyl]hydrazine |
|---|---|
| PubChem CID | 105204290 |
| Molecular Formula | C15H28N2O2 |
| Molecular Weight | 268.40 g/mol |
| Exact Mass | 268.22 |
| IUPAC Name | [cyclopentyl(1,9-dioxaspiro[5.5]undecan-4-yl)methyl]hydrazine |
| SMILES | NNC(C1CCCC1)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C15H28N2O2/c16-17-14(12-3-1-2-4-12)13-5-8-19-15(11-13)6-9-18-10-7-15/h12-14,17H,1-11,16H2 |
| InChIKey | RQZQFFUXFNMCJG-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 56.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 268.40 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|