C15H27NO2 — CID 103169144
2-cyclobutyl-1-(1,9-dioxaspiro[5.5]undecan-4-yl)ethanamine (PubChem CID 103169144) has the molecular formula C15H27NO2 and a molecular weight of 253.39 g/mol. Its IUPAC name is 2-cyclobutyl-1-(1,9-dioxaspiro[5.5]undecan-4-yl)ethanamine.
| Compound Name | 2-cyclobutyl-1-(1,9-dioxaspiro[5.5]undecan-4-yl)ethanamine |
|---|---|
| PubChem CID | 103169144 |
| Molecular Formula | C15H27NO2 |
| Molecular Weight | 253.39 g/mol |
| Exact Mass | 253.20 |
| IUPAC Name | 2-cyclobutyl-1-(1,9-dioxaspiro[5.5]undecan-4-yl)ethanamine |
| SMILES | NC(CC1CCC1)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C15H27NO2/c16-14(10-12-2-1-3-12)13-4-7-18-15(11-13)5-8-17-9-6-15/h12-14H,1-11,16H2 |
| InChIKey | RQSUINUVMVZDCL-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.39 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |