C14H27NO2 — CID 79911282
1-(1,9-dioxaspiro[5.5]undecan-4-yl)pentan-1-amine (PubChem CID 79911282) has the molecular formula C14H27NO2 and a molecular weight of 241.37 g/mol. Its IUPAC name is 1-(1,9-dioxaspiro[5.5]undecan-4-yl)pentan-1-amine.
| Compound Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)pentan-1-amine |
|---|---|
| PubChem CID | 79911282 |
| Molecular Formula | C14H27NO2 |
| Molecular Weight | 241.37 g/mol |
| Exact Mass | 241.20 |
| IUPAC Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)pentan-1-amine |
| SMILES | CCCCC(N)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C14H27NO2/c1-2-3-4-13(15)12-5-8-17-14(11-12)6-9-16-10-7-14/h12-13H,2-11,15H2,1H3 |
| InChIKey | KQLWJQDOARAYCS-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.37 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |