C17H33NO2 — CID 79911722
1-(1,9-dioxaspiro[5.5]undecan-4-yl)-N-propylpentan-1-amine (PubChem CID 79911722) has the molecular formula C17H33NO2 and a molecular weight of 283.46 g/mol. Its IUPAC name is 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-N-propylpentan-1-amine.
| Compound Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-N-propylpentan-1-amine |
|---|---|
| PubChem CID | 79911722 |
| Molecular Formula | C17H33NO2 |
| Molecular Weight | 283.46 g/mol |
| Exact Mass | 283.25 |
| IUPAC Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-N-propylpentan-1-amine |
| SMILES | CCCCC(NCCC)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C17H33NO2/c1-3-5-6-16(18-10-4-2)15-7-11-20-17(14-15)8-12-19-13-9-17/h15-16,18H,3-14H2,1-2H3 |
| InChIKey | KWLHWOSAUIPWPV-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.46 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |