C11H19NO4 — CID 106702805
(2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid (PubChem CID 106702805) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is (2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid.
| Compound Name | (2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid |
|---|---|
| PubChem CID | 106702805 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | (2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid |
| SMILES | N[C@@H](C(=O)O)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C11H19NO4/c12-9(10(13)14)8-1-4-16-11(7-8)2-5-15-6-3-11/h8-9H,1-7,12H2,(H,13,14)/t8?,9-/m1/s1 |
| InChIKey | DLURZOFPDRTLEP-YGPZHTELSA-N |
| XLogP | 0.37 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |