(2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid

C11H19NO4 — CID 106702805

IUPAC(2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid
SMILESN[C@@H](C(=O)O)C1CCOC2(CCOCC2)C1
InChIInChI=1S/C11H19NO4/c12-9(10(13)14)8-1-4-16-11(7-8)2-5-15-6-3-11/h8-9H,1-7,12H2,(H,13,14)/t8?,9-/m1/s1
InChIKeyDLURZOFPDRTLEP-YGPZHTELSA-N
MW229.28 g/mol
LogP0.37
Rot. Bonds2

About (2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid

(2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid (PubChem CID 106702805) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is (2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid.

Molecular Properties

Compound Name(2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid
PubChem CID106702805
Molecular FormulaC11H19NO4
Molecular Weight229.28 g/mol
Exact Mass229.13
IUPAC Name(2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid
SMILESN[C@@H](C(=O)O)C1CCOC2(CCOCC2)C1
InChIInChI=1S/C11H19NO4/c12-9(10(13)14)8-1-4-16-11(7-8)2-5-15-6-3-11/h8-9H,1-7,12H2,(H,13,14)/t8?,9-/m1/s1
InChIKeyDLURZOFPDRTLEP-YGPZHTELSA-N
XLogP0.37
TPSA81.78 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds2
Heavy Atoms16
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500229.28
LogP ≤ 50.37
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Analyze (2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid?
The IUPAC name of (2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid (CID 106702805) is (2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid.
What is the SMILES notation for (2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid?
The canonical SMILES for (2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid is N[C@@H](C(=O)O)C1CCOC2(CCOCC2)C1.
What is the InChIKey of (2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid?
The InChIKey is DLURZOFPDRTLEP-YGPZHTELSA-N. The full InChI is InChI=1S/C11H19NO4/c12-9(10(13)14)8-1-4-16-11(7-8)2-5-15-6-3-11/h8-9H,1-7,12H2,(H,13,14)/t8?,9-/m1/s1.
What are the key properties of (2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid?
(2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid has a molecular weight of 229.28 g/mol, XLogP of 0.37, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-amino-2-(1,9-dioxaspiro[5.5]undecan-4-yl)acetic acid is sourced from PubChem (CID 106702805), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).