2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-formamidoacetic acid

C12H19NO5 — CID 79905611

IUPAC2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-formamidoacetic acid
SMILESO=CNC(C(=O)O)C1CCOC2(CCOCC2)C1
InChIInChI=1S/C12H19NO5/c14-8-13-10(11(15)16)9-1-4-18-12(7-9)2-5-17-6-3-12/h8-10H,1-7H2,(H,13,14)(H,15,16)
InChIKeyUMCNPTBHFVGZHW-UHFFFAOYSA-N
MW257.29 g/mol
LogP0.16
Rot. Bonds4

About 2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-formamidoacetic acid

2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-formamidoacetic acid (PubChem CID 79905611) has the molecular formula C12H19NO5 and a molecular weight of 257.29 g/mol. Its IUPAC name is 2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-formamidoacetic acid.

Molecular Properties

Compound Name2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-formamidoacetic acid
PubChem CID79905611
Molecular FormulaC12H19NO5
Molecular Weight257.29 g/mol
Exact Mass257.13
IUPAC Name2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-formamidoacetic acid
SMILESO=CNC(C(=O)O)C1CCOC2(CCOCC2)C1
InChIInChI=1S/C12H19NO5/c14-8-13-10(11(15)16)9-1-4-18-12(7-9)2-5-17-6-3-12/h8-10H,1-7H2,(H,13,14)(H,15,16)
InChIKeyUMCNPTBHFVGZHW-UHFFFAOYSA-N
XLogP0.16
TPSA84.86 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500257.29
LogP ≤ 50.16
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'aldehyde', 'substructure': 'N/A'}

Analyze 2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-formamidoacetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-formamidoacetic acid?
The IUPAC name of 2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-formamidoacetic acid (CID 79905611) is 2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-formamidoacetic acid.
What is the SMILES notation for 2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-formamidoacetic acid?
The canonical SMILES for 2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-formamidoacetic acid is O=CNC(C(=O)O)C1CCOC2(CCOCC2)C1.
What is the InChIKey of 2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-formamidoacetic acid?
The InChIKey is UMCNPTBHFVGZHW-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19NO5/c14-8-13-10(11(15)16)9-1-4-18-12(7-9)2-5-17-6-3-12/h8-10H,1-7H2,(H,13,14)(H,15,16).
What are the key properties of 2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-formamidoacetic acid?
2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-formamidoacetic acid has a molecular weight of 257.29 g/mol, XLogP of 0.16, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,9-dioxaspiro[5.5]undecan-4-yl)-2-formamidoacetic acid is sourced from PubChem (CID 79905611), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).