C16H29NO2 — CID 79914524
cyclohexyl(1,9-dioxaspiro[5.5]undecan-4-yl)methanamine (PubChem CID 79914524) has the molecular formula C16H29NO2 and a molecular weight of 267.41 g/mol. Its IUPAC name is cyclohexyl(1,9-dioxaspiro[5.5]undecan-4-yl)methanamine.
| Compound Name | cyclohexyl(1,9-dioxaspiro[5.5]undecan-4-yl)methanamine |
|---|---|
| PubChem CID | 79914524 |
| Molecular Formula | C16H29NO2 |
| Molecular Weight | 267.41 g/mol |
| Exact Mass | 267.22 |
| IUPAC Name | cyclohexyl(1,9-dioxaspiro[5.5]undecan-4-yl)methanamine |
| SMILES | NC(C1CCCCC1)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C16H29NO2/c17-15(13-4-2-1-3-5-13)14-6-9-19-16(12-14)7-10-18-11-8-16/h13-15H,1-12,17H2 |
| InChIKey | RNNWNMOBHZLTFD-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.41 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |