C13H25NO4 — CID 79911630
1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2,2-dimethoxyethanamine (PubChem CID 79911630) has the molecular formula C13H25NO4 and a molecular weight of 259.35 g/mol. Its IUPAC name is 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2,2-dimethoxyethanamine.
| Compound Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2,2-dimethoxyethanamine |
|---|---|
| PubChem CID | 79911630 |
| Molecular Formula | C13H25NO4 |
| Molecular Weight | 259.35 g/mol |
| Exact Mass | 259.18 |
| IUPAC Name | 1-(1,9-dioxaspiro[5.5]undecan-4-yl)-2,2-dimethoxyethanamine |
| SMILES | COC(OC)C(N)C1CCOC2(CCOCC2)C1 |
| InChI | InChI=1S/C13H25NO4/c1-15-12(16-2)11(14)10-3-6-18-13(9-10)4-7-17-8-5-13/h10-12H,3-9,14H2,1-2H3 |
| InChIKey | MEUPQCXKSJIRKC-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.35 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|