C15H27NO4 — CID 116764369
2,6-dioxaspiro[4.5]decan-9-yl-(4-methoxyoxan-4-yl)methanamine (PubChem CID 116764369) has the molecular formula C15H27NO4 and a molecular weight of 285.38 g/mol. Its IUPAC name is 2,6-dioxaspiro[4.5]decan-9-yl-(4-methoxyoxan-4-yl)methanamine.
| Compound Name | 2,6-dioxaspiro[4.5]decan-9-yl-(4-methoxyoxan-4-yl)methanamine |
|---|---|
| PubChem CID | 116764369 |
| Molecular Formula | C15H27NO4 |
| Molecular Weight | 285.38 g/mol |
| Exact Mass | 285.19 |
| IUPAC Name | 2,6-dioxaspiro[4.5]decan-9-yl-(4-methoxyoxan-4-yl)methanamine |
| SMILES | COC1(C(N)C2CCOC3(CCOC3)C2)CCOCC1 |
| InChI | InChI=1S/C15H27NO4/c1-17-15(4-8-18-9-5-15)13(16)12-2-6-20-14(10-12)3-7-19-11-14/h12-13H,2-11,16H2,1H3 |
| InChIKey | ZIPKVJOGGBJLGB-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 62.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |