C11H19NO4 — CID 79905755
methyl 2-amino-2-(2,6-dioxaspiro[4.5]decan-9-yl)acetate (PubChem CID 79905755) has the molecular formula C11H19NO4 and a molecular weight of 229.28 g/mol. Its IUPAC name is methyl 2-amino-2-(2,6-dioxaspiro[4.5]decan-9-yl)acetate.
| Compound Name | methyl 2-amino-2-(2,6-dioxaspiro[4.5]decan-9-yl)acetate |
|---|---|
| PubChem CID | 79905755 |
| Molecular Formula | C11H19NO4 |
| Molecular Weight | 229.28 g/mol |
| Exact Mass | 229.13 |
| IUPAC Name | methyl 2-amino-2-(2,6-dioxaspiro[4.5]decan-9-yl)acetate |
| SMILES | COC(=O)C(N)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C11H19NO4/c1-14-10(13)9(12)8-2-4-16-11(6-8)3-5-15-7-11/h8-9H,2-7,12H2,1H3 |
| InChIKey | KGADWHPGZXONAJ-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.28 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |