C12H24N2O4 — CID 105246210
[1-(2,6-dioxaspiro[4.5]decan-9-yl)-2,2-dimethoxyethyl]hydrazine (PubChem CID 105246210) has the molecular formula C12H24N2O4 and a molecular weight of 260.33 g/mol. Its IUPAC name is [1-(2,6-dioxaspiro[4.5]decan-9-yl)-2,2-dimethoxyethyl]hydrazine.
| Compound Name | [1-(2,6-dioxaspiro[4.5]decan-9-yl)-2,2-dimethoxyethyl]hydrazine |
|---|---|
| PubChem CID | 105246210 |
| Molecular Formula | C12H24N2O4 |
| Molecular Weight | 260.33 g/mol |
| Exact Mass | 260.17 |
| IUPAC Name | [1-(2,6-dioxaspiro[4.5]decan-9-yl)-2,2-dimethoxyethyl]hydrazine |
| SMILES | COC(OC)C(NN)C1CCOC2(CCOC2)C1 |
| InChI | InChI=1S/C12H24N2O4/c1-15-11(16-2)10(14-13)9-3-5-18-12(7-9)4-6-17-8-12/h9-11,14H,3-8,13H2,1-2H3 |
| InChIKey | OTKADDFWVOMFOS-UHFFFAOYSA-N |
| XLogP | 0.02 |
| TPSA | 74.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.33 |
| LogP ≤ 5 | 0.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|